C22H17FN4O2 — CID 53002239
1-(4-fluorophenyl)-N-(4-methoxyphenyl)-5-pyridin-3-ylpyrazole-3-carboxamide (PubChem CID 53002239) has the molecular formula C22H17FN4O2 and a molecular weight of 388.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(4-methoxyphenyl)-5-pyridin-3-ylpyrazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(4-methoxyphenyl)-5-pyridin-3-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 53002239 |
| Molecular Formula | C22H17FN4O2 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(4-methoxyphenyl)-5-pyridin-3-ylpyrazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(-c3cccnc3)n(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C22H17FN4O2/c1-29-19-10-6-17(7-11-19)25-22(28)20-13-21(15-3-2-12-24-14-15)27(26-20)18-8-4-16(23)5-9-18/h2-14H,1H3,(H,25,28) |
| InChIKey | MGXQNHIIWKOJAD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |