C24H21FN4O — CID 53067767
1-(4-fluorophenyl)-N-(3-phenylpropyl)-5-pyridin-3-ylpyrazole-3-carboxamide (PubChem CID 53067767) has the molecular formula C24H21FN4O and a molecular weight of 400.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(3-phenylpropyl)-5-pyridin-3-ylpyrazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(3-phenylpropyl)-5-pyridin-3-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 53067767 |
| Molecular Formula | C24H21FN4O |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(3-phenylpropyl)-5-pyridin-3-ylpyrazole-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cc(-c2cccnc2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C24H21FN4O/c25-20-10-12-21(13-11-20)29-23(19-9-5-14-26-17-19)16-22(28-29)24(30)27-15-4-8-18-6-2-1-3-7-18/h1-3,5-7,9-14,16-17H,4,8,15H2,(H,27,30) |
| InChIKey | VLWYMEQSJGLYTG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|