C26H25N5O3 — CID 55775986
5-(4-methoxyphenyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1-phenylpyrazole-3-carboxamide (PubChem CID 55775986) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1-phenylpyrazole-3-carboxamide.
| Compound Name | 5-(4-methoxyphenyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55775986 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 5-(4-methoxyphenyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccc(N4CCOCC4)nc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N5O3/c1-33-22-10-7-19(8-11-22)24-17-23(29-31(24)21-5-3-2-4-6-21)26(32)28-20-9-12-25(27-18-20)30-13-15-34-16-14-30/h2-12,17-18H,13-16H2,1H3,(H,28,32) |
| InChIKey | QJCCDTNRVLMIMK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |