C18H20ClN5O3S — CID 118440569
8-butan-2-yl-2-chloro-6-[(4-methylsulfonylphenyl)methylamino]pteridin-7-one (PubChem CID 118440569) has the molecular formula C18H20ClN5O3S and a molecular weight of 421.91 g/mol. Its IUPAC name is 8-butan-2-yl-2-chloro-6-[(4-methylsulfonylphenyl)methylamino]pteridin-7-one.
| Compound Name | 8-butan-2-yl-2-chloro-6-[(4-methylsulfonylphenyl)methylamino]pteridin-7-one |
|---|---|
| PubChem CID | 118440569 |
| Molecular Formula | C18H20ClN5O3S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 8-butan-2-yl-2-chloro-6-[(4-methylsulfonylphenyl)methylamino]pteridin-7-one |
| SMILES | CCC(C)n1c(=O)c(NCc2ccc(S(C)(=O)=O)cc2)nc2cnc(Cl)nc21 |
| InChI | InChI=1S/C18H20ClN5O3S/c1-4-11(2)24-16-14(10-21-18(19)23-16)22-15(17(24)25)20-9-12-5-7-13(8-6-12)28(3,26)27/h5-8,10-11H,4,9H2,1-3H3,(H,20,22) |
| InChIKey | GLPBTWYWJDGLSS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |