C16H18ClN7O3S — CID 118440658
6-[[[2-chloro-8-(2-methylpropyl)-7-oxopteridin-6-yl]amino]methyl]pyridine-3-sulfonamide (PubChem CID 118440658) has the molecular formula C16H18ClN7O3S and a molecular weight of 423.89 g/mol. Its IUPAC name is 6-[[[2-chloro-8-(2-methylpropyl)-7-oxopteridin-6-yl]amino]methyl]pyridine-3-sulfonamide.
| Compound Name | 6-[[[2-chloro-8-(2-methylpropyl)-7-oxopteridin-6-yl]amino]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118440658 |
| Molecular Formula | C16H18ClN7O3S |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 6-[[[2-chloro-8-(2-methylpropyl)-7-oxopteridin-6-yl]amino]methyl]pyridine-3-sulfonamide |
| SMILES | CC(C)Cn1c(=O)c(NCc2ccc(S(N)(=O)=O)cn2)nc2cnc(Cl)nc21 |
| InChI | InChI=1S/C16H18ClN7O3S/c1-9(2)8-24-14-12(7-21-16(17)23-14)22-13(15(24)25)20-5-10-3-4-11(6-19-10)28(18,26)27/h3-4,6-7,9H,5,8H2,1-2H3,(H,20,22)(H2,18,26,27) |
| InChIKey | KXSIBCJWMGPRCS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 145.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |