C39H24N4O2 — CID 118441937
12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-[1,4]benzodioxino[2,3-a]carbazole (PubChem CID 118441937) has the molecular formula C39H24N4O2 and a molecular weight of 580.65 g/mol. Its IUPAC name is 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-[1,4]benzodioxino[2,3-a]carbazole.
| Compound Name | 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-[1,4]benzodioxino[2,3-a]carbazole |
|---|---|
| PubChem CID | 118441937 |
| Molecular Formula | C39H24N4O2 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-[1,4]benzodioxino[2,3-a]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5ccc6c(c54)Oc4ccccc4O6)cc3)n2)cc1 |
| InChI | InChI=1S/C39H24N4O2/c1-3-11-25(12-4-1)37-40-38(26-13-5-2-6-14-26)42-39(41-37)27-19-21-28(22-20-27)43-31-16-8-7-15-29(31)30-23-24-34-36(35(30)43)45-33-18-10-9-17-32(33)44-34/h1-24H |
| InChIKey | COOFDBGSTASFFC-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |