C22H34O3 — CID 118442636
(3S,5R,8R,9S,10R,13S,14S,17S)-3-hydroxy-17-(3-hydroxyprop-1-en-2-yl)-3,13-dimethyl-1,2,4,5,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one (PubChem CID 118442636) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (3S,5R,8R,9S,10R,13S,14S,17S)-3-hydroxy-17-(3-hydroxyprop-1-en-2-yl)-3,13-dimethyl-1,2,4,5,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | (3S,5R,8R,9S,10R,13S,14S,17S)-3-hydroxy-17-(3-hydroxyprop-1-en-2-yl)-3,13-dimethyl-1,2,4,5,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 118442636 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (3S,5R,8R,9S,10R,13S,14S,17S)-3-hydroxy-17-(3-hydroxyprop-1-en-2-yl)-3,13-dimethyl-1,2,4,5,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| SMILES | C=C(CO)[C@H]1CC[C@H]2[C@@H]3CC(=O)[C@@H]4C[C@@](C)(O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H34O3/c1-13(12-23)18-4-5-19-16-10-20(24)17-11-21(2,25)8-6-15(17)14(16)7-9-22(18,19)3/h14-19,23,25H,1,4-12H2,2-3H3/t14-,15-,16-,17-,18-,19+,21+,22-/m1/s1 |
| InChIKey | PVQWUHJZPDVZFC-YEHWKBADSA-N |
| XLogP | 3.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|