C12H21FN2O — CID 118444517
(3-fluoroazetidin-3-yl)-[(3R)-3-methyl-3-propan-2-ylpyrrolidin-1-yl]methanone (PubChem CID 118444517) has the molecular formula C12H21FN2O and a molecular weight of 228.31 g/mol. Its IUPAC name is (3-fluoroazetidin-3-yl)-[(3R)-3-methyl-3-propan-2-ylpyrrolidin-1-yl]methanone.
| Compound Name | (3-fluoroazetidin-3-yl)-[(3R)-3-methyl-3-propan-2-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118444517 |
| Molecular Formula | C12H21FN2O |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (3-fluoroazetidin-3-yl)-[(3R)-3-methyl-3-propan-2-ylpyrrolidin-1-yl]methanone |
| SMILES | CC(C)[C@@]1(C)CCN(C(=O)C2(F)CNC2)C1 |
| InChI | InChI=1S/C12H21FN2O/c1-9(2)11(3)4-5-15(8-11)10(16)12(13)6-14-7-12/h9,14H,4-8H2,1-3H3/t11-/m0/s1 |
| InChIKey | CNACHGRKDUBLIU-NSHDSACASA-N |
| XLogP | 1.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |