About azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate
azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate (PubChem CID 118444576) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate |
| PubChem CID | 118444576 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate |
| SMILES | CC(C)[C@@]1(C)CCN(C(=O)OCC2CNC2)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-10(2)13(3)4-5-15(9-13)12(16)17-8-11-6-14-7-11/h10-11,14H,4-9H2,1-3H3/t13-/m0/s1 |
| InChIKey | LJXCYLGYMMJOLY-ZDUSSCGKSA-N |
| XLogP | 1.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate?
The IUPAC name of azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate (CID 118444576) is azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate.
What is the SMILES notation for azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate?
The canonical SMILES for azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate is CC(C)[C@@]1(C)CCN(C(=O)OCC2CNC2)C1.
What is the InChIKey of azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate?
The InChIKey is LJXCYLGYMMJOLY-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-10(2)13(3)4-5-15(9-13)12(16)17-8-11-6-14-7-11/h10-11,14H,4-9H2,1-3H3/t13-/m0/s1.
What are the key properties of azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate?
azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate has a molecular weight of 240.35 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-ylmethyl (3R)-3-methyl-3-propan-2-ylpyrrolidine-1-carboxylate is sourced from PubChem (CID 118444576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).