C15H27NO3 — CID 118444498
ethyl 2,2-dimethyl-3-[(3R)-3-methyl-3-propan-2-ylpyrrolidin-1-yl]-3-oxopropanoate (PubChem CID 118444498) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-3-[(3R)-3-methyl-3-propan-2-ylpyrrolidin-1-yl]-3-oxopropanoate.
| Compound Name | ethyl 2,2-dimethyl-3-[(3R)-3-methyl-3-propan-2-ylpyrrolidin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 118444498 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | ethyl 2,2-dimethyl-3-[(3R)-3-methyl-3-propan-2-ylpyrrolidin-1-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)N1CC[C@](C)(C(C)C)C1 |
| InChI | InChI=1S/C15H27NO3/c1-7-19-13(18)14(4,5)12(17)16-9-8-15(6,10-16)11(2)3/h11H,7-10H2,1-6H3/t15-/m0/s1 |
| InChIKey | ZQVQQXSLVFNDHS-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|