C13H14ClN3O2 — CID 11844762
2-chloro-N-[(2,5-dimethoxyphenyl)methyl]pyrimidin-4-amine (PubChem CID 11844762) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 2-chloro-N-[(2,5-dimethoxyphenyl)methyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[(2,5-dimethoxyphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11844762 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-chloro-N-[(2,5-dimethoxyphenyl)methyl]pyrimidin-4-amine |
| SMILES | COc1ccc(OC)c(CNc2ccnc(Cl)n2)c1 |
| InChI | InChI=1S/C13H14ClN3O2/c1-18-10-3-4-11(19-2)9(7-10)8-16-12-5-6-15-13(14)17-12/h3-7H,8H2,1-2H3,(H,15,16,17) |
| InChIKey | ZCTGCFMFDXYJPP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |