C14H17N3O3 — CID 154758297
6-[(2,5-dimethoxyphenyl)methylamino]-2-methylpyridazin-3-one (PubChem CID 154758297) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-[(2,5-dimethoxyphenyl)methylamino]-2-methylpyridazin-3-one.
| Compound Name | 6-[(2,5-dimethoxyphenyl)methylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 154758297 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 6-[(2,5-dimethoxyphenyl)methylamino]-2-methylpyridazin-3-one |
| SMILES | COc1ccc(OC)c(CNc2ccc(=O)n(C)n2)c1 |
| InChI | InChI=1S/C14H17N3O3/c1-17-14(18)7-6-13(16-17)15-9-10-8-11(19-2)4-5-12(10)20-3/h4-8H,9H2,1-3H3,(H,15,16) |
| InChIKey | GOBZFGSVWZLOJG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |