C14H22O2Si — CID 11845013
trans-(2S,3R)-2-but-3-enyl-3-hydroxy-2-(2-trimethylsilylethynyl)cyclopentan-1-one (PubChem CID 11845013) has the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. Its IUPAC name is trans-(2S,3R)-2-but-3-enyl-3-hydroxy-2-(2-trimethylsilylethynyl)cyclopentan-1-one.
| Compound Name | trans-(2S,3R)-2-but-3-enyl-3-hydroxy-2-(2-trimethylsilylethynyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 11845013 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | trans-(2S,3R)-2-but-3-enyl-3-hydroxy-2-(2-trimethylsilylethynyl)cyclopentan-1-one |
| SMILES | C=CCC[C@@]1(C#C[Si](C)(C)C)C(=O)CC[C@H]1O |
| InChI | InChI=1S/C14H22O2Si/c1-5-6-9-14(10-11-17(2,3)4)12(15)7-8-13(14)16/h5,12,15H,1,6-9H2,2-4H3/t12-,14+/m1/s1 |
| InChIKey | OXMZJSUMGGMTNK-OCCSQVGLSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|