C21H38O2Si2 — CID 53381778
trans-(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-pent-4-enyl-2-(2-trimethylsilylethynyl)cyclopentan-1-one (PubChem CID 53381778) has the molecular formula C21H38O2Si2 and a molecular weight of 378.71 g/mol. Its IUPAC name is trans-(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-pent-4-enyl-2-(2-trimethylsilylethynyl)cyclopentan-1-one.
| Compound Name | trans-(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-pent-4-enyl-2-(2-trimethylsilylethynyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 53381778 |
| Molecular Formula | C21H38O2Si2 |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | trans-(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-pent-4-enyl-2-(2-trimethylsilylethynyl)cyclopentan-1-one |
| SMILES | C=CCCC[C@@]1(C#C[Si](C)(C)C)C(=O)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O2Si2/c1-10-11-12-15-21(16-17-24(5,6)7)18(22)13-14-19(21)23-25(8,9)20(2,3)4/h10,19H,1,11-15H2,2-9H3/t19-,21-/m1/s1 |
| InChIKey | LMYIBLBBRIITBV-TZIWHRDSSA-N |
| XLogP | 5.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|