C19H20F2O2S — CID 118451687
3-ethoxy-4,6-difluoro-7-pentoxydibenzothiophene (PubChem CID 118451687) has the molecular formula C19H20F2O2S and a molecular weight of 350.43 g/mol. Its IUPAC name is 3-ethoxy-4,6-difluoro-7-pentoxydibenzothiophene.
| Compound Name | 3-ethoxy-4,6-difluoro-7-pentoxydibenzothiophene |
|---|---|
| PubChem CID | 118451687 |
| Molecular Formula | C19H20F2O2S |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-ethoxy-4,6-difluoro-7-pentoxydibenzothiophene |
| SMILES | CCCCCOc1ccc2c(sc3c(F)c(OCC)ccc32)c1F |
| InChI | InChI=1S/C19H20F2O2S/c1-3-5-6-11-23-15-10-8-13-12-7-9-14(22-4-2)16(20)18(12)24-19(13)17(15)21/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | BTNCIKXPDUEVKP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|