C10H18F2N2O — CID 118454405
1-(3,3-difluorooxan-4-yl)piperidin-4-amine (PubChem CID 118454405) has the molecular formula C10H18F2N2O and a molecular weight of 220.26 g/mol. Its IUPAC name is 1-(3,3-difluorooxan-4-yl)piperidin-4-amine.
| Compound Name | 1-(3,3-difluorooxan-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 118454405 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 1-(3,3-difluorooxan-4-yl)piperidin-4-amine |
| SMILES | NC1CCN(C2CCOCC2(F)F)CC1 |
| InChI | InChI=1S/C10H18F2N2O/c11-10(12)7-15-6-3-9(10)14-4-1-8(13)2-5-14/h8-9H,1-7,13H2 |
| InChIKey | NBFNFXJLUSHJMF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |