C10H19FN2O — CID 118454807
1-[(3S,4R)-3-fluorooxan-4-yl]piperidin-4-amine (PubChem CID 118454807) has the molecular formula C10H19FN2O and a molecular weight of 202.27 g/mol. Its IUPAC name is 1-[(3S,4R)-3-fluorooxan-4-yl]piperidin-4-amine.
| Compound Name | 1-[(3S,4R)-3-fluorooxan-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 118454807 |
| Molecular Formula | C10H19FN2O |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-[(3S,4R)-3-fluorooxan-4-yl]piperidin-4-amine |
| SMILES | NC1CCN([C@@H]2CCOC[C@H]2F)CC1 |
| InChI | InChI=1S/C10H19FN2O/c11-9-7-14-6-3-10(9)13-4-1-8(12)2-5-13/h8-10H,1-7,12H2/t9-,10-/m1/s1 |
| InChIKey | MVJKVWMLFOXRTP-NXEZZACHSA-N |
| XLogP | 0.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |