C13H25FN2O — CID 167249154
1-[(3R,4R)-3-fluorooxan-4-yl]-N-propan-2-ylpiperidin-4-amine (PubChem CID 167249154) has the molecular formula C13H25FN2O and a molecular weight of 244.35 g/mol. Its IUPAC name is 1-[(3R,4R)-3-fluorooxan-4-yl]-N-propan-2-ylpiperidin-4-amine.
| Compound Name | 1-[(3R,4R)-3-fluorooxan-4-yl]-N-propan-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 167249154 |
| Molecular Formula | C13H25FN2O |
| Molecular Weight | 244.35 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 1-[(3R,4R)-3-fluorooxan-4-yl]-N-propan-2-ylpiperidin-4-amine |
| SMILES | CC(C)NC1CCN([C@@H]2CCOC[C@@H]2F)CC1 |
| InChI | InChI=1S/C13H25FN2O/c1-10(2)15-11-3-6-16(7-4-11)13-5-8-17-9-12(13)14/h10-13,15H,3-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | WHGGQVOPNLSUNK-QWHCGFSZSA-N |
| XLogP | 1.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |