C5H10FNO — CID 86337690
(3R,4S)-4-fluorooxan-3-amine (PubChem CID 86337690) has the molecular formula C5H10FNO and a molecular weight of 119.14 g/mol. Its IUPAC name is (3R,4S)-4-fluorooxan-3-amine.
| Compound Name | (3R,4S)-4-fluorooxan-3-amine |
|---|---|
| PubChem CID | 86337690 |
| Molecular Formula | C5H10FNO |
| Molecular Weight | 119.14 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | (3R,4S)-4-fluorooxan-3-amine |
| SMILES | N[C@@H]1COCC[C@@H]1F |
| InChI | InChI=1S/C5H10FNO/c6-4-1-2-8-3-5(4)7/h4-5H,1-3,7H2/t4-,5+/m0/s1 |
| InChIKey | NMAXCYNKJLHMPY-CRCLSJGQSA-N |
| XLogP | 0.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.14 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |