About (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen
(3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen (PubChem CID 177003690) has the molecular formula C6H13FO
and a molecular weight of 120.17 g/mol. Its IUPAC name is (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen.
Molecular Properties
| Compound Name | (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen |
| PubChem CID | 177003690 |
| Molecular Formula | C6H13FO |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.10 |
| IUPAC Name | (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen |
| SMILES | C[C@H]1CCOC[C@H]1F.[H][H] |
| InChI | InChI=1S/C6H11FO.H2/c1-5-2-3-8-4-6(5)7;/h5-6H,2-4H2,1H3;1H/t5-,6+;/m0./s1 |
| InChIKey | KOYREIJRAKNMQA-RIHPBJNCSA-N |
| XLogP | 1.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen?
The IUPAC name of (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen (CID 177003690) is (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen.
What is the SMILES notation for (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen?
The canonical SMILES for (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen is C[C@H]1CCOC[C@H]1F.[H][H].
What is the InChIKey of (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen?
The InChIKey is KOYREIJRAKNMQA-RIHPBJNCSA-N. The full InChI is InChI=1S/C6H11FO.H2/c1-5-2-3-8-4-6(5)7;/h5-6H,2-4H2,1H3;1H/t5-,6+;/m0./s1.
What are the key properties of (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen?
(3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen has a molecular weight of 120.17 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen is sourced from PubChem (CID 177003690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).