C6H13FO — CID 177003690
(3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen (PubChem CID 177003690) has the molecular formula C6H13FO and a molecular weight of 120.17 g/mol. Its IUPAC name is (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen.
| Compound Name | (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen |
|---|---|
| PubChem CID | 177003690 |
| Molecular Formula | C6H13FO |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.10 |
| IUPAC Name | (3S,4S)-3-fluoro-4-methyloxane;molecular hydrogen |
| SMILES | C[C@H]1CCOC[C@H]1F.[H][H] |
| InChI | InChI=1S/C6H11FO.H2/c1-5-2-3-8-4-6(5)7;/h5-6H,2-4H2,1H3;1H/t5-,6+;/m0./s1 |
| InChIKey | KOYREIJRAKNMQA-RIHPBJNCSA-N |
| XLogP | 1.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |