C16H29FO2 — CID 129305132
(1S,2S,4R)-5-(4-tert-butyloxan-3-yl)-2-fluoro-4-methylcyclohexan-1-ol (PubChem CID 129305132) has the molecular formula C16H29FO2 and a molecular weight of 272.40 g/mol. Its IUPAC name is (1S,2S,4R)-5-(4-tert-butyloxan-3-yl)-2-fluoro-4-methylcyclohexan-1-ol.
| Compound Name | (1S,2S,4R)-5-(4-tert-butyloxan-3-yl)-2-fluoro-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 129305132 |
| Molecular Formula | C16H29FO2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | (1S,2S,4R)-5-(4-tert-butyloxan-3-yl)-2-fluoro-4-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1C[C@H](F)[C@@H](O)CC1C1COCCC1C(C)(C)C |
| InChI | InChI=1S/C16H29FO2/c1-10-7-14(17)15(18)8-11(10)12-9-19-6-5-13(12)16(2,3)4/h10-15,18H,5-9H2,1-4H3/t10-,11?,12?,13?,14+,15+/m1/s1 |
| InChIKey | JXZOLYQQTQGNPQ-UTTRAMIUSA-N |
| XLogP | 3.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |