About 6-fluorooxepan-4-ol
6-fluorooxepan-4-ol (PubChem CID 176685604) has the molecular formula C6H11FO2
and a molecular weight of 134.15 g/mol. Its IUPAC name is 6-fluorooxepan-4-ol.
Molecular Properties
| Compound Name | 6-fluorooxepan-4-ol |
| PubChem CID | 176685604 |
| Molecular Formula | C6H11FO2 |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 6-fluorooxepan-4-ol |
| SMILES | OC1CCOCC(F)C1 |
| InChI | InChI=1S/C6H11FO2/c7-5-3-6(8)1-2-9-4-5/h5-6,8H,1-4H2 |
| InChIKey | QHVKDIWSHGJLPO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluorooxepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorooxepan-4-ol?
The IUPAC name of 6-fluorooxepan-4-ol (CID 176685604) is 6-fluorooxepan-4-ol.
What is the SMILES notation for 6-fluorooxepan-4-ol?
The canonical SMILES for 6-fluorooxepan-4-ol is OC1CCOCC(F)C1.
What is the InChIKey of 6-fluorooxepan-4-ol?
The InChIKey is QHVKDIWSHGJLPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO2/c7-5-3-6(8)1-2-9-4-5/h5-6,8H,1-4H2.
What are the key properties of 6-fluorooxepan-4-ol?
6-fluorooxepan-4-ol has a molecular weight of 134.15 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorooxepan-4-ol is sourced from PubChem (CID 176685604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).