About ethane;oxepane-3,5-diol
ethane;oxepane-3,5-diol (PubChem CID 176685419) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is ethane;oxepane-3,5-diol.
Molecular Properties
| Compound Name | ethane;oxepane-3,5-diol |
| PubChem CID | 176685419 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | ethane;oxepane-3,5-diol |
| SMILES | CC.OC1CCOCC(O)C1 |
| InChI | InChI=1S/C6H12O3.C2H6/c7-5-1-2-9-4-6(8)3-5;1-2/h5-8H,1-4H2;1-2H3 |
| InChIKey | BNFWTIMNEAGNIU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;oxepane-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;oxepane-3,5-diol?
The IUPAC name of ethane;oxepane-3,5-diol (CID 176685419) is ethane;oxepane-3,5-diol.
What is the SMILES notation for ethane;oxepane-3,5-diol?
The canonical SMILES for ethane;oxepane-3,5-diol is CC.OC1CCOCC(O)C1.
What is the InChIKey of ethane;oxepane-3,5-diol?
The InChIKey is BNFWTIMNEAGNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C2H6/c7-5-1-2-9-4-6(8)3-5;1-2/h5-8H,1-4H2;1-2H3.
What are the key properties of ethane;oxepane-3,5-diol?
ethane;oxepane-3,5-diol has a molecular weight of 162.23 g/mol, XLogP of 0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;oxepane-3,5-diol is sourced from PubChem (CID 176685419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).