C8H14O2 — CID 14982330
(3R,4S)-4-prop-1-en-2-yloxan-3-ol (PubChem CID 14982330) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (3R,4S)-4-prop-1-en-2-yloxan-3-ol.
| Compound Name | (3R,4S)-4-prop-1-en-2-yloxan-3-ol |
|---|---|
| PubChem CID | 14982330 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (3R,4S)-4-prop-1-en-2-yloxan-3-ol |
| SMILES | C=C(C)[C@@H]1CCOC[C@@H]1O |
| InChI | InChI=1S/C8H14O2/c1-6(2)7-3-4-10-5-8(7)9/h7-9H,1,3-5H2,2H3/t7-,8-/m0/s1 |
| InChIKey | SKPHTXPGYVNRDK-YUMQZZPRSA-N |
| XLogP | 0.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|