C8H18N2O — CID 71741908
4-N-propan-2-yloxane-3,4-diamine (PubChem CID 71741908) has the molecular formula C8H18N2O and a molecular weight of 158.25 g/mol. Its IUPAC name is 4-N-propan-2-yloxane-3,4-diamine.
| Compound Name | 4-N-propan-2-yloxane-3,4-diamine |
|---|---|
| PubChem CID | 71741908 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 4-N-propan-2-yloxane-3,4-diamine |
| SMILES | CC(C)NC1CCOCC1N |
| InChI | InChI=1S/C8H18N2O/c1-6(2)10-8-3-4-11-5-7(8)9/h6-8,10H,3-5,9H2,1-2H3 |
| InChIKey | BNJQGARJJPFWFU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |