About (3S,4S)-3,4-di(propan-2-yl)oxane
(3S,4S)-3,4-di(propan-2-yl)oxane (PubChem CID 121421969) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is (3S,4S)-3,4-di(propan-2-yl)oxane.
Molecular Properties
| Compound Name | (3S,4S)-3,4-di(propan-2-yl)oxane |
| PubChem CID | 121421969 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (3S,4S)-3,4-di(propan-2-yl)oxane |
| SMILES | CC(C)[C@@H]1CCOC[C@H]1C(C)C |
| InChI | InChI=1S/C11H22O/c1-8(2)10-5-6-12-7-11(10)9(3)4/h8-11H,5-7H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | XVAQKZZOTXSYBG-QWRGUYRKSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S,4S)-3,4-di(propan-2-yl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3,4-di(propan-2-yl)oxane?
The IUPAC name of (3S,4S)-3,4-di(propan-2-yl)oxane (CID 121421969) is (3S,4S)-3,4-di(propan-2-yl)oxane.
What is the SMILES notation for (3S,4S)-3,4-di(propan-2-yl)oxane?
The canonical SMILES for (3S,4S)-3,4-di(propan-2-yl)oxane is CC(C)[C@@H]1CCOC[C@H]1C(C)C.
What is the InChIKey of (3S,4S)-3,4-di(propan-2-yl)oxane?
The InChIKey is XVAQKZZOTXSYBG-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H22O/c1-8(2)10-5-6-12-7-11(10)9(3)4/h8-11H,5-7H2,1-4H3/t10-,11-/m0/s1.
What are the key properties of (3S,4S)-3,4-di(propan-2-yl)oxane?
(3S,4S)-3,4-di(propan-2-yl)oxane has a molecular weight of 170.30 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3,4-di(propan-2-yl)oxane is sourced from PubChem (CID 121421969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).