C15H32O — CID 161401744
3,4-di(propan-2-yl)oxolane;2-methylbutane (PubChem CID 161401744) has the molecular formula C15H32O and a molecular weight of 228.42 g/mol. Its IUPAC name is 3,4-di(propan-2-yl)oxolane;2-methylbutane.
| Compound Name | 3,4-di(propan-2-yl)oxolane;2-methylbutane |
|---|---|
| PubChem CID | 161401744 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | 3,4-di(propan-2-yl)oxolane;2-methylbutane |
| SMILES | CC(C)C1COCC1C(C)C.CCC(C)C |
| InChI | InChI=1S/C10H20O.C5H12/c1-7(2)9-5-11-6-10(9)8(3)4;1-4-5(2)3/h7-10H,5-6H2,1-4H3;5H,4H2,1-3H3 |
| InChIKey | VUIBLLLBARWKNP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |