About bicyclo[1.1.0]butane;ethane;2-methylbutane
bicyclo[1.1.0]butane;ethane;2-methylbutane (PubChem CID 142057154) has the molecular formula C13H30
and a molecular weight of 186.38 g/mol. Its IUPAC name is bicyclo[1.1.0]butane;ethane;2-methylbutane.
Molecular Properties
| Compound Name | bicyclo[1.1.0]butane;ethane;2-methylbutane |
| PubChem CID | 142057154 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | bicyclo[1.1.0]butane;ethane;2-methylbutane |
| SMILES | C1C2CC12.CC.CC.CCC(C)C |
| InChI | InChI=1S/C5H12.C4H6.2C2H6/c1-4-5(2)3;1-3-2-4(1)3;2*1-2/h5H,4H2,1-3H3;3-4H,1-2H2;2*1-2H3 |
| InChIKey | ZWXJWWHVCGBXAF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bicyclo[1.1.0]butane;ethane;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[1.1.0]butane;ethane;2-methylbutane?
The IUPAC name of bicyclo[1.1.0]butane;ethane;2-methylbutane (CID 142057154) is bicyclo[1.1.0]butane;ethane;2-methylbutane.
What is the SMILES notation for bicyclo[1.1.0]butane;ethane;2-methylbutane?
The canonical SMILES for bicyclo[1.1.0]butane;ethane;2-methylbutane is C1C2CC12.CC.CC.CCC(C)C.
What is the InChIKey of bicyclo[1.1.0]butane;ethane;2-methylbutane?
The InChIKey is ZWXJWWHVCGBXAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.C4H6.2C2H6/c1-4-5(2)3;1-3-2-4(1)3;2*1-2/h5H,4H2,1-3H3;3-4H,1-2H2;2*1-2H3.
What are the key properties of bicyclo[1.1.0]butane;ethane;2-methylbutane?
bicyclo[1.1.0]butane;ethane;2-methylbutane has a molecular weight of 186.38 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[1.1.0]butane;ethane;2-methylbutane is sourced from PubChem (CID 142057154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).