C11H24O2 — CID 145319923
cyclohexane-1,4-diol;2-methylbutane (PubChem CID 145319923) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is cyclohexane-1,4-diol;2-methylbutane.
| Compound Name | cyclohexane-1,4-diol;2-methylbutane |
|---|---|
| PubChem CID | 145319923 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | cyclohexane-1,4-diol;2-methylbutane |
| SMILES | CCC(C)C.OC1CCC(O)CC1 |
| InChI | InChI=1S/C6H12O2.C5H12/c7-5-1-2-6(8)4-3-5;1-4-5(2)3/h5-8H,1-4H2;5H,4H2,1-3H3 |
| InChIKey | XUYGOQQQITXDLX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |