About 4-butan-2-yloxolan-3-ol
4-butan-2-yloxolan-3-ol (PubChem CID 147418216) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 4-butan-2-yloxolan-3-ol.
Molecular Properties
| Compound Name | 4-butan-2-yloxolan-3-ol |
| PubChem CID | 147418216 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 4-butan-2-yloxolan-3-ol |
| SMILES | CCC(C)C1COCC1O |
| InChI | InChI=1S/C8H16O2/c1-3-6(2)7-4-10-5-8(7)9/h6-9H,3-5H2,1-2H3 |
| InChIKey | DRYJSDOTQQWNJD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butan-2-yloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yloxolan-3-ol?
The IUPAC name of 4-butan-2-yloxolan-3-ol (CID 147418216) is 4-butan-2-yloxolan-3-ol.
What is the SMILES notation for 4-butan-2-yloxolan-3-ol?
The canonical SMILES for 4-butan-2-yloxolan-3-ol is CCC(C)C1COCC1O.
What is the InChIKey of 4-butan-2-yloxolan-3-ol?
The InChIKey is DRYJSDOTQQWNJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-3-6(2)7-4-10-5-8(7)9/h6-9H,3-5H2,1-2H3.
What are the key properties of 4-butan-2-yloxolan-3-ol?
4-butan-2-yloxolan-3-ol has a molecular weight of 144.21 g/mol, XLogP of 1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yloxolan-3-ol is sourced from PubChem (CID 147418216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).