C10H18N2O — CID 130942023
(3R,4S)-4-(2-azabicyclo[3.1.0]hexan-2-yl)oxan-3-amine (PubChem CID 130942023) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (3R,4S)-4-(2-azabicyclo[3.1.0]hexan-2-yl)oxan-3-amine.
| Compound Name | (3R,4S)-4-(2-azabicyclo[3.1.0]hexan-2-yl)oxan-3-amine |
|---|---|
| PubChem CID | 130942023 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (3R,4S)-4-(2-azabicyclo[3.1.0]hexan-2-yl)oxan-3-amine |
| SMILES | N[C@H]1COCC[C@@H]1N1CCC2CC21 |
| InChI | InChI=1S/C10H18N2O/c11-8-6-13-4-2-9(8)12-3-1-7-5-10(7)12/h7-10H,1-6,11H2/t7?,8-,9-,10?/m0/s1 |
| InChIKey | TUCHWBDTCNJIIM-ZNHWEVIXSA-N |
| XLogP | 0.20 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |