C11H20F3N3O — CID 62967867
3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]oxan-4-amine (PubChem CID 62967867) has the molecular formula C11H20F3N3O and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]oxan-4-amine.
| Compound Name | 3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]oxan-4-amine |
|---|---|
| PubChem CID | 62967867 |
| Molecular Formula | C11H20F3N3O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]oxan-4-amine |
| SMILES | NC1CCOCC1N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H20F3N3O/c12-11(13,14)8-16-2-4-17(5-3-16)10-7-18-6-1-9(10)15/h9-10H,1-8,15H2 |
| InChIKey | ZYNWXHCNHKSTRP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |