About [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine
[4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine (PubChem CID 62968920) has the molecular formula C14H26F3N3
and a molecular weight of 293.38 g/mol. Its IUPAC name is [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine |
| PubChem CID | 62968920 |
| Molecular Formula | C14H26F3N3 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine |
| SMILES | CC1CCC(CN)C(N2CCN(CC(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C14H26F3N3/c1-11-2-3-12(9-18)13(8-11)20-6-4-19(5-7-20)10-14(15,16)17/h11-13H,2-10,18H2,1H3 |
| InChIKey | TUUXZSKBRIGMIL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine?
The IUPAC name of [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine (CID 62968920) is [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine.
What is the SMILES notation for [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine?
The canonical SMILES for [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine is CC1CCC(CN)C(N2CCN(CC(F)(F)F)CC2)C1.
What is the InChIKey of [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine?
The InChIKey is TUUXZSKBRIGMIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F3N3/c1-11-2-3-12(9-18)13(8-11)20-6-4-19(5-7-20)10-14(15,16)17/h11-13H,2-10,18H2,1H3.
What are the key properties of [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine?
[4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine has a molecular weight of 293.38 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexyl]methanamine is sourced from PubChem (CID 62968920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).