C7H11N — CID 131843917
1-azatricyclo[4.2.0.02,4]octane (PubChem CID 131843917) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 1-azatricyclo[4.2.0.02,4]octane.
| Compound Name | 1-azatricyclo[4.2.0.02,4]octane |
|---|---|
| PubChem CID | 131843917 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 1-azatricyclo[4.2.0.02,4]octane |
| SMILES | C1CN2C1CC1CC12 |
| InChI | InChI=1S/C7H11N/c1-2-8-6(1)3-5-4-7(5)8/h5-7H,1-4H2 |
| InChIKey | JKPLZVYXOSCJFT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |