C11H20N2 — CID 88971570
5-ethyl-2,5-diazatricyclo[6.2.1.02,7]undecane (PubChem CID 88971570) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 5-ethyl-2,5-diazatricyclo[6.2.1.02,7]undecane.
| Compound Name | 5-ethyl-2,5-diazatricyclo[6.2.1.02,7]undecane |
|---|---|
| PubChem CID | 88971570 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 5-ethyl-2,5-diazatricyclo[6.2.1.02,7]undecane |
| SMILES | CCN1CCN2C3CCC(C3)C2C1 |
| InChI | InChI=1S/C11H20N2/c1-2-12-5-6-13-10-4-3-9(7-10)11(13)8-12/h9-11H,2-8H2,1H3 |
| InChIKey | UAZFRMUTVDFVCA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |