C9H16N2 — CID 74874734
2,5-diazatricyclo[6.2.1.02,7]undecane (PubChem CID 74874734) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,5-diazatricyclo[6.2.1.02,7]undecane.
| Compound Name | 2,5-diazatricyclo[6.2.1.02,7]undecane |
|---|---|
| PubChem CID | 74874734 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2,5-diazatricyclo[6.2.1.02,7]undecane |
| SMILES | C1CN2C3CCC(C3)C2CN1 |
| InChI | InChI=1S/C9H16N2/c1-2-8-5-7(1)9-6-10-3-4-11(8)9/h7-10H,1-6H2 |
| InChIKey | FXDOBDLENLQBBY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |