About 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine
4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine (PubChem CID 134321617) has the molecular formula C13H24N4O
and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine.
Molecular Properties
| Compound Name | 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine |
| PubChem CID | 134321617 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine |
| SMILES | NC1CNCCC1N1CCN(C2COC2)C2CC21 |
| InChI | InChI=1S/C13H24N4O/c14-10-6-15-2-1-11(10)17-4-3-16(9-7-18-8-9)12-5-13(12)17/h9-13,15H,1-8,14H2 |
| InChIKey | WAYHCCOKXKTQDX-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine?
The IUPAC name of 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine (CID 134321617) is 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine.
What is the SMILES notation for 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine?
The canonical SMILES for 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine is NC1CNCCC1N1CCN(C2COC2)C2CC21.
What is the InChIKey of 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine?
The InChIKey is WAYHCCOKXKTQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O/c14-10-6-15-2-1-11(10)17-4-3-16(9-7-18-8-9)12-5-13(12)17/h9-13,15H,1-8,14H2.
What are the key properties of 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine?
4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine has a molecular weight of 252.36 g/mol, XLogP of -1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(oxetan-3-yl)-2,5-diazabicyclo[4.1.0]heptan-2-yl]piperidin-3-amine is sourced from PubChem (CID 134321617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).