C17H15Cl2NO3 — CID 118455918
2,4-dichloro-1-[1-(4-nitrophenoxy)cyclopentyl]benzene (PubChem CID 118455918) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2,4-dichloro-1-[1-(4-nitrophenoxy)cyclopentyl]benzene.
| Compound Name | 2,4-dichloro-1-[1-(4-nitrophenoxy)cyclopentyl]benzene |
|---|---|
| PubChem CID | 118455918 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2,4-dichloro-1-[1-(4-nitrophenoxy)cyclopentyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(OC2(c3ccc(Cl)cc3Cl)CCCC2)cc1 |
| InChI | InChI=1S/C17H15Cl2NO3/c18-12-3-8-15(16(19)11-12)17(9-1-2-10-17)23-14-6-4-13(5-7-14)20(21)22/h3-8,11H,1-2,9-10H2 |
| InChIKey | PDJJSHYKDDAXHE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|