C24H46N2 — CID 118457573
N,N-bis(2-ethylhexyl)-1,2,6-trimethyl-2H-pyridin-4-amine (PubChem CID 118457573) has the molecular formula C24H46N2 and a molecular weight of 362.65 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-1,2,6-trimethyl-2H-pyridin-4-amine.
| Compound Name | N,N-bis(2-ethylhexyl)-1,2,6-trimethyl-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 118457573 |
| Molecular Formula | C24H46N2 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 362.37 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-1,2,6-trimethyl-2H-pyridin-4-amine |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C1=CC(C)N(C)C(C)=C1 |
| InChI | InChI=1S/C24H46N2/c1-8-12-14-22(10-3)18-26(19-23(11-4)15-13-9-2)24-16-20(5)25(7)21(6)17-24/h16-17,20,22-23H,8-15,18-19H2,1-7H3 |
| InChIKey | HVYJUIHWNQRVIM-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |