About 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene
6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene (PubChem CID 118457653) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene.
Molecular Properties
| Compound Name | 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene |
| PubChem CID | 118457653 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene |
| SMILES | CC1=NCC2(CCCC2)N(C)C1 |
| InChI | InChI=1S/C10H18N2/c1-9-7-12(2)10(8-11-9)5-3-4-6-10/h3-8H2,1-2H3 |
| InChIKey | CKWCUZYXGLUACT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene?
The IUPAC name of 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene (CID 118457653) is 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene.
What is the SMILES notation for 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene?
The canonical SMILES for 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene is CC1=NCC2(CCCC2)N(C)C1.
What is the InChIKey of 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene?
The InChIKey is CKWCUZYXGLUACT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-9-7-12(2)10(8-11-9)5-3-4-6-10/h3-8H2,1-2H3.
What are the key properties of 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene?
6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene has a molecular weight of 166.27 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethyl-6,9-diazaspiro[4.5]dec-8-ene is sourced from PubChem (CID 118457653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).