C21H32N4O4 — CID 118457699
(2R)-N-cyclopropyl-N-[(1R)-1-[4-[2-(hydroxyamino)ethoxy]-5,6,7,8-tetrahydroquinolin-2-yl]ethyl]morpholine-2-carboxamide (PubChem CID 118457699) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-N-[(1R)-1-[4-[2-(hydroxyamino)ethoxy]-5,6,7,8-tetrahydroquinolin-2-yl]ethyl]morpholine-2-carboxamide.
| Compound Name | (2R)-N-cyclopropyl-N-[(1R)-1-[4-[2-(hydroxyamino)ethoxy]-5,6,7,8-tetrahydroquinolin-2-yl]ethyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 118457699 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (2R)-N-cyclopropyl-N-[(1R)-1-[4-[2-(hydroxyamino)ethoxy]-5,6,7,8-tetrahydroquinolin-2-yl]ethyl]morpholine-2-carboxamide |
| SMILES | C[C@H](c1cc(OCCNO)c2c(n1)CCCC2)N(C(=O)[C@H]1CNCCO1)C1CC1 |
| InChI | InChI=1S/C21H32N4O4/c1-14(25(15-6-7-15)21(26)20-13-22-8-10-29-20)18-12-19(28-11-9-23-27)16-4-2-3-5-17(16)24-18/h12,14-15,20,22-23,27H,2-11,13H2,1H3/t14-,20-/m1/s1 |
| InChIKey | ICHQCTYRIVXBPB-JLTOFOAXSA-N |
| XLogP | 1.36 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|