C24H34N4O4 — CID 90065007
(2R)-N-cyclopropyl-N-[(1R)-1-[6-methoxy-4-[3-(methoxyamino)propyl]quinolin-2-yl]ethyl]morpholine-2-carboxamide (PubChem CID 90065007) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-N-[(1R)-1-[6-methoxy-4-[3-(methoxyamino)propyl]quinolin-2-yl]ethyl]morpholine-2-carboxamide.
| Compound Name | (2R)-N-cyclopropyl-N-[(1R)-1-[6-methoxy-4-[3-(methoxyamino)propyl]quinolin-2-yl]ethyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 90065007 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (2R)-N-cyclopropyl-N-[(1R)-1-[6-methoxy-4-[3-(methoxyamino)propyl]quinolin-2-yl]ethyl]morpholine-2-carboxamide |
| SMILES | CONCCCc1cc([C@@H](C)N(C(=O)[C@H]2CNCCO2)C2CC2)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C24H34N4O4/c1-16(28(18-6-7-18)24(29)23-15-25-11-12-32-23)22-13-17(5-4-10-26-31-3)20-14-19(30-2)8-9-21(20)27-22/h8-9,13-14,16,18,23,25-26H,4-7,10-12,15H2,1-3H3/t16-,23-/m1/s1 |
| InChIKey | CVFYETLEZSZYFV-WAIKUNEKSA-N |
| XLogP | 2.37 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|