C23H30FN3O3S — CID 90065178
(2R)-N-cyclopropyl-N-[(1R)-1-[5-(2-fluorophenyl)-4-[3-(hydroxyamino)propyl]thiophen-2-yl]ethyl]morpholine-2-carboxamide (PubChem CID 90065178) has the molecular formula C23H30FN3O3S and a molecular weight of 447.58 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-N-[(1R)-1-[5-(2-fluorophenyl)-4-[3-(hydroxyamino)propyl]thiophen-2-yl]ethyl]morpholine-2-carboxamide.
| Compound Name | (2R)-N-cyclopropyl-N-[(1R)-1-[5-(2-fluorophenyl)-4-[3-(hydroxyamino)propyl]thiophen-2-yl]ethyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 90065178 |
| Molecular Formula | C23H30FN3O3S |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (2R)-N-cyclopropyl-N-[(1R)-1-[5-(2-fluorophenyl)-4-[3-(hydroxyamino)propyl]thiophen-2-yl]ethyl]morpholine-2-carboxamide |
| SMILES | C[C@H](c1cc(CCCNO)c(-c2ccccc2F)s1)N(C(=O)[C@H]1CNCCO1)C1CC1 |
| InChI | InChI=1S/C23H30FN3O3S/c1-15(27(17-8-9-17)23(28)20-14-25-11-12-30-20)21-13-16(5-4-10-26-29)22(31-21)18-6-2-3-7-19(18)24/h2-3,6-7,13,15,17,20,25-26,29H,4-5,8-12,14H2,1H3/t15-,20-/m1/s1 |
| InChIKey | ZGHHIODPPUWGSX-FOIQADDNSA-N |
| XLogP | 3.51 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|