C24H32N4O4S — CID 118313850
methyl N-[3-[5-[1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]-3-pyridin-3-ylthiophen-2-yl]propyl]carbamate (PubChem CID 118313850) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is methyl N-[3-[5-[1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]-3-pyridin-3-ylthiophen-2-yl]propyl]carbamate.
| Compound Name | methyl N-[3-[5-[1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]-3-pyridin-3-ylthiophen-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 118313850 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | methyl N-[3-[5-[1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]-3-pyridin-3-ylthiophen-2-yl]propyl]carbamate |
| SMILES | COC(=O)NCCCc1sc(C(C)N(C(=O)[C@H]2CNCCO2)C2CC2)cc1-c1cccnc1 |
| InChI | InChI=1S/C24H32N4O4S/c1-16(28(18-7-8-18)23(29)20-15-26-11-12-32-20)22-13-19(17-5-3-9-25-14-17)21(33-22)6-4-10-27-24(30)31-2/h3,5,9,13-14,16,18,20,26H,4,6-8,10-12,15H2,1-2H3,(H,27,30)/t16?,20-/m1/s1 |
| InChIKey | DFNDBTWIXXECEN-OTOKDRCRSA-N |
| XLogP | 3.14 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|