C23H34N2O4S — CID 158216437
methyl N-[3-[2-cyclopropyl-5-[1-[cyclopropyl-[(2R)-oxane-2-carbonyl]amino]ethyl]thiophen-3-yl]propyl]carbamate (PubChem CID 158216437) has the molecular formula C23H34N2O4S and a molecular weight of 434.60 g/mol. Its IUPAC name is methyl N-[3-[2-cyclopropyl-5-[1-[cyclopropyl-[(2R)-oxane-2-carbonyl]amino]ethyl]thiophen-3-yl]propyl]carbamate.
| Compound Name | methyl N-[3-[2-cyclopropyl-5-[1-[cyclopropyl-[(2R)-oxane-2-carbonyl]amino]ethyl]thiophen-3-yl]propyl]carbamate |
|---|---|
| PubChem CID | 158216437 |
| Molecular Formula | C23H34N2O4S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl N-[3-[2-cyclopropyl-5-[1-[cyclopropyl-[(2R)-oxane-2-carbonyl]amino]ethyl]thiophen-3-yl]propyl]carbamate |
| SMILES | COC(=O)NCCCc1cc(C(C)N(C(=O)[C@H]2CCCCO2)C2CC2)sc1C1CC1 |
| InChI | InChI=1S/C23H34N2O4S/c1-15(25(18-10-11-18)22(26)19-7-3-4-13-29-19)20-14-17(21(30-20)16-8-9-16)6-5-12-24-23(27)28-2/h14-16,18-19H,3-13H2,1-2H3,(H,24,27)/t15?,19-/m1/s1 |
| InChIKey | GCSCCOBCIMQUTP-XCWJXAQQSA-N |
| XLogP | 4.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|