C25H40N4O4 — CID 160884849
methyl N-[3-[1-cyclohexyl-3-[(1R)-1-[cyclopropyl-[(2R)-oxane-2-carbonyl]amino]ethyl]pyrazol-5-yl]propyl]carbamate (PubChem CID 160884849) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is methyl N-[3-[1-cyclohexyl-3-[(1R)-1-[cyclopropyl-[(2R)-oxane-2-carbonyl]amino]ethyl]pyrazol-5-yl]propyl]carbamate.
| Compound Name | methyl N-[3-[1-cyclohexyl-3-[(1R)-1-[cyclopropyl-[(2R)-oxane-2-carbonyl]amino]ethyl]pyrazol-5-yl]propyl]carbamate |
|---|---|
| PubChem CID | 160884849 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | methyl N-[3-[1-cyclohexyl-3-[(1R)-1-[cyclopropyl-[(2R)-oxane-2-carbonyl]amino]ethyl]pyrazol-5-yl]propyl]carbamate |
| SMILES | COC(=O)NCCCc1cc([C@@H](C)N(C(=O)[C@H]2CCCCO2)C2CC2)nn1C1CCCCC1 |
| InChI | InChI=1S/C25H40N4O4/c1-18(28(19-13-14-19)24(30)23-12-6-7-16-33-23)22-17-21(11-8-15-26-25(31)32-2)29(27-22)20-9-4-3-5-10-20/h17-20,23H,3-16H2,1-2H3,(H,26,31)/t18-,23-/m1/s1 |
| InChIKey | SNMSQGJKJRMAPG-WZONZLPQSA-N |
| XLogP | 4.30 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|