C26H41N7O4S — CID 162126898
azane;methyl N-[3-[2-(4-carbamimidoylphenyl)-5-[(1R)-1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]thiophen-3-yl]propyl]carbamate (PubChem CID 162126898) has the molecular formula C26H41N7O4S and a molecular weight of 547.73 g/mol. Its IUPAC name is azane;methyl N-[3-[2-(4-carbamimidoylphenyl)-5-[(1R)-1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]thiophen-3-yl]propyl]carbamate.
| Compound Name | azane;methyl N-[3-[2-(4-carbamimidoylphenyl)-5-[(1R)-1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]thiophen-3-yl]propyl]carbamate |
|---|---|
| PubChem CID | 162126898 |
| Molecular Formula | C26H41N7O4S |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | azane;methyl N-[3-[2-(4-carbamimidoylphenyl)-5-[(1R)-1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]thiophen-3-yl]propyl]carbamate |
| SMILES | N.N.[H]/N=C(\N)c1ccc(-c2sc([C@@H](C)N(C(=O)[C@H]3CNCCO3)C3CC3)cc2CCCNC(=O)OC)cc1 |
| InChI | InChI=1S/C26H35N5O4S.2H3N/c1-16(31(20-9-10-20)25(32)21-15-29-12-13-35-21)22-14-19(4-3-11-30-26(33)34-2)23(36-22)17-5-7-18(8-6-17)24(27)28;;/h5-8,14,16,20-21,29H,3-4,9-13,15H2,1-2H3,(H3,27,28)(H,30,33);2*1H3/t16-,21-;;/m1../s1 |
| InChIKey | BBXLXUPBJNGSHY-VHXSFILTSA-N |
| XLogP | 3.35 |
| TPSA | 199.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|