C21H31FN4O3 — CID 144588397
(2R)-N-cyclopropyl-N-[(2R)-1-[3-fluoro-2-(4-hydroxybutylamino)phenyl]-1-iminopropan-2-yl]morpholine-2-carboxamide (PubChem CID 144588397) has the molecular formula C21H31FN4O3 and a molecular weight of 406.50 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-N-[(2R)-1-[3-fluoro-2-(4-hydroxybutylamino)phenyl]-1-iminopropan-2-yl]morpholine-2-carboxamide.
| Compound Name | (2R)-N-cyclopropyl-N-[(2R)-1-[3-fluoro-2-(4-hydroxybutylamino)phenyl]-1-iminopropan-2-yl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 144588397 |
| Molecular Formula | C21H31FN4O3 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (2R)-N-cyclopropyl-N-[(2R)-1-[3-fluoro-2-(4-hydroxybutylamino)phenyl]-1-iminopropan-2-yl]morpholine-2-carboxamide |
| SMILES | [H]/N=C(/c1cccc(F)c1NCCCCO)[C@@H](C)N(C(=O)[C@H]1CNCCO1)C1CC1 |
| InChI | InChI=1S/C21H31FN4O3/c1-14(26(15-7-8-15)21(28)18-13-24-10-12-29-18)19(23)16-5-4-6-17(22)20(16)25-9-2-3-11-27/h4-6,14-15,18,23-25,27H,2-3,7-13H2,1H3/b23-19+/t14-,18-/m1/s1 |
| InChIKey | FWYOYJABDDVSBR-HIZANQFRSA-N |
| XLogP | 1.75 |
| TPSA | 97.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|