C23H35FN4O2 — CID 144588393
(2R)-N-[(Z,2R)-3-amino-5-(butylamino)-5-(3-fluorophenyl)pent-4-en-2-yl]-N-cyclopropylmorpholine-2-carboxamide (PubChem CID 144588393) has the molecular formula C23H35FN4O2 and a molecular weight of 418.56 g/mol. Its IUPAC name is (2R)-N-[(Z,2R)-3-amino-5-(butylamino)-5-(3-fluorophenyl)pent-4-en-2-yl]-N-cyclopropylmorpholine-2-carboxamide.
| Compound Name | (2R)-N-[(Z,2R)-3-amino-5-(butylamino)-5-(3-fluorophenyl)pent-4-en-2-yl]-N-cyclopropylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 144588393 |
| Molecular Formula | C23H35FN4O2 |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (2R)-N-[(Z,2R)-3-amino-5-(butylamino)-5-(3-fluorophenyl)pent-4-en-2-yl]-N-cyclopropylmorpholine-2-carboxamide |
| SMILES | CCCCN/C(=C\C(N)[C@@H](C)N(C(=O)[C@H]1CNCCO1)C1CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H35FN4O2/c1-3-4-10-27-21(17-6-5-7-18(24)13-17)14-20(25)16(2)28(19-8-9-19)23(29)22-15-26-11-12-30-22/h5-7,13-14,16,19-20,22,26-27H,3-4,8-12,15,25H2,1-2H3/b21-14-/t16-,20?,22-/m1/s1 |
| InChIKey | HWOJTQSSAYOQDC-KAYUTVSGSA-N |
| XLogP | 2.25 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|