C22H23FOS — CID 118457953
2-[3-(1-Benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxane (PubChem CID 118457953) has the molecular formula C22H23FOS and a molecular weight of 354.50 g/mol. Its IUPAC name is 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxane.
| Compound Name | 2-[3-(1-Benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxane |
|---|---|
| PubChem CID | 118457953 |
| Molecular Formula | C22H23FOS |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxane |
| SMILES | CC1CCC(OC1C2=CC(=C(C=C2)F)CC3=CC4=CC=CC=C4S3)C |
| InChI | InChI=1S/C22H23FOS/c1-14-7-8-15(2)24-22(14)17-9-10-20(23)18(11-17)13-19-12-16-5-3-4-6-21(16)25-19/h3-6,9-12,14-15,22H,7-8,13H2,1-2H3 |
| InChIKey | OEDKGYPZXMOXGE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 37.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | 444 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |